CAS 63458-98-0 appears in our catalog under these names: 1-(3,4-Dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione, 98%, 1-(3,4-dimethoxyphenyl)-4,4,4-trifluoro-3-hydroxybut-2-en-1-one, 98%. Offered by: AmBeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 50mg, 5g, 250mg, 1g, 100mg, 500mg, 2.5g.
1-(3,4-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 63458-98-0) is a chemical compound with the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: QYQACDYPMNIAMN-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O4 |
|---|---|
| Molecular weight | 276.21 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | QYQACDYPMNIAMN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CC(=O)C(F)(F)F)OC |
Computed by PubChem (NCBI)