Products 15278-30-5
CAS 15278-30-5 appears in our catalog under these names: 1-(2,5-Dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione, 98%, 1-(2,5-Dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 10g, 25g, 5g, 100g.
1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 15278-30-5) is a chemical compound with the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. IUPAC name: 1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: YJZDMHRCYCYRKB-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O4 |
|---|---|
| Molecular weight | 276.21 g/mol |
| IUPAC name | 1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | YJZDMHRCYCYRKB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)