CAS 63492-82-0 appears in our catalog under these names: (S)-Methyl 1,2,3,4-tetrahydroquinoline-2-carboxylate, 95+%, (S)–Methyl 1,2,3,4–tetrahydroquinoline–2–carboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 25mg.
Methyl (2S)-1,2,3,4-tetrahydroquinoline-2-carboxylate (CAS 63492-82-0) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: methyl (2S)-1,2,3,4-tetrahydroquinoline-2-carboxylate. InChIKey: ACEPYLDNGYGKDY-JTQLQIEISA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | methyl (2S)-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| InChIKey | ACEPYLDNGYGKDY-JTQLQIEISA-N |
| SMILES | COC(=O)[C@@H]1CCC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)