CAS 635305-38-3 is the registry number for 2–(3–bromophenyl)–5,5–dimethyl–1,3,2–dioxaborinane. Offered by: GLPBio. Available pack sizes: 1g, 5g.
2-(3-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 635305-38-3) is a chemical compound with the molecular formula C11H14BBrO2 and a molecular weight of 268.94 g/mol. IUPAC name: 2-(3-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: WPAFNRZWMSDHOK-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrO2 |
|---|---|
| Molecular weight | 268.94 g/mol |
| IUPAC name | 2-(3-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | WPAFNRZWMSDHOK-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)