CAS 884010-16-6 appears in our catalog under these names: 2,2–dimethylpropane–1,3–diyl (2–bromophenyl) boronate, 2-(2-Bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg.
2-(2-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 884010-16-6) is a chemical compound with the molecular formula C11H14BBrO2 and a molecular weight of 268.94 g/mol. IUPAC name: 2-(2-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: ZSUJRJZJYFVWCG-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrO2 |
|---|---|
| Molecular weight | 268.94 g/mol |
| IUPAC name | 2-(2-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | ZSUJRJZJYFVWCG-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)