CAS 63555-02-2 is the registry number for Breynioside A. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 4-hydroxybenzoate (CAS 63555-02-2) is a chemical compound with the molecular formula C19H20O9 and a molecular weight of 392.4 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 4-hydroxybenzoate. InChIKey: FTFZXPBVBBJTHV-OGJJZOIMSA-N.
| Molecular formula | C19H20O9 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl 4-hydroxybenzoate |
| InChIKey | FTFZXPBVBBJTHV-OGJJZOIMSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC=C(C=C3)O)O)O)O)O |
Computed by PubChem (NCBI)