Products 636-53-3
CAS 636-53-3 appears in our catalog under these names: Diethyl isophthalate, Diethyl isophthalate 98%, Diethyl isophthalate, 98%, 98%, Diethyl isophthalate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 500g, 5g, 10g, 25g, 100g, 1kg, 1g.
Diethyl benzene-1,3-dicarboxylate (CAS 636-53-3) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: diethyl benzene-1,3-dicarboxylate. InChIKey: JLVWYWVLMFVCDI-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | diethyl benzene-1,3-dicarboxylate |
| InChIKey | JLVWYWVLMFVCDI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
DIETHYL ISOPHTHALATE, 1,3-Benzenedicarboxylic acid, diethyl ester, Isophthalic acid, diethyl ester, DIETHYL ISOPHTHALATE [HSDB], 1,3-Benzenedicarboxylic acid, 1,3-diethyl ester, 1,3Benzenedicarboxylic acid, diethyl ester, diethyl benzene-1,3-dicarboxylate, Diethyl isophthlate, isophthalic acid diethyl ester, Diethyl m-phthalate