CAS 63633-85-2 appears in our catalog under these names: Methyl 1,1,3-trioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylate, 95%, Methyl 1,1,3-trioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
Methyl 1,1,3-trioxo-1,2-benzothiazole-6-carboxylate (CAS 63633-85-2) is a chemical compound with the molecular formula C9H7NO5S and a molecular weight of 241.22 g/mol. IUPAC name: methyl 1,1,3-trioxo-1,2-benzothiazole-6-carboxylate. InChIKey: STEQISJLUQULIO-UHFFFAOYSA-N.
| Molecular formula | C9H7NO5S |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | methyl 1,1,3-trioxo-1,2-benzothiazole-6-carboxylate |
| InChIKey | STEQISJLUQULIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=O)NS2(=O)=O |
Computed by PubChem (NCBI)