CAS 656819-53-3 appears in our catalog under these names: 3-Oxo-3,4-dihydro-2H-benzo(b)(1,4)thiazine-6-carboxylic acid 1,1-dioxide, 95+%, 3-Oxo-3,4-dihydro-2H-benzo(b)(1,4)thiazine-6-carboxylic acid 1,1-dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,1,3-trioxo-4H-1lambda6,4-benzothiazine-6-carboxylic acid (CAS 656819-53-3) is a chemical compound with the molecular formula C9H7NO5S and a molecular weight of 241.22 g/mol. IUPAC name: 1,1,3-trioxo-4H-1lambda6,4-benzothiazine-6-carboxylic acid. InChIKey: NJHBEJOAYHXVTE-UHFFFAOYSA-N.
| Molecular formula | C9H7NO5S |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 1,1,3-trioxo-4H-1lambda6,4-benzothiazine-6-carboxylic acid |
| InChIKey | NJHBEJOAYHXVTE-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1(=O)=O)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)