Products 6367-42-6
CAS 6367-42-6 appears in our catalog under these names: H-D-Asp-obzl, 98%, H–D–Asp–Obzl, Bzl-D-Asp-OH 98%, H-D-ASP-OBZL, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 10g, 100mg, 250mg.
(2R)-2-(benzylamino)butanedioic acid (CAS 6367-42-6) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2R)-2-(benzylamino)butanedioic acid. InChIKey: RKSKSWSMXZYPFW-SECBINFHSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2R)-2-(benzylamino)butanedioic acid |
| InChIKey | RKSKSWSMXZYPFW-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)