CAS 63674-63-5 is the registry number for 1-(3,5-Dimethylphenyl)-5-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
1-(3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 63674-63-5) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: ZVYUEYJQRCOJDI-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | ZVYUEYJQRCOJDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2CC(CC2=O)C(=O)O)C |
Computed by PubChem (NCBI)