CAS 63678-14-8 is the registry number for 2,2,6-Trimethyl-2,3-dihydro-4H-chromen-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2,2,6-trimethyl-3H-chromen-4-one (CAS 63678-14-8) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 2,2,6-trimethyl-3H-chromen-4-one. InChIKey: MWCLIHHFUUYVDF-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2,2,6-trimethyl-3H-chromen-4-one |
| InChIKey | MWCLIHHFUUYVDF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(CC2=O)(C)C |
Computed by PubChem (NCBI)