CAS 6378-90-1 is the registry number for Diacetyl-3,3’-Dinitrobenzidine. Offered by: TRC. Available pack sizes: 100g, 10g.
N-[4-(4-acetamido-3-nitrophenyl)-2-nitrophenyl]acetamide (CAS 6378-90-1) is a chemical compound with the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. IUPAC name: N-[4-(4-acetamido-3-nitrophenyl)-2-nitrophenyl]acetamide. InChIKey: VGFDUXNDMUMYHD-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O6 |
|---|---|
| Molecular weight | 358.31 g/mol |
| IUPAC name | N-[4-(4-acetamido-3-nitrophenyl)-2-nitrophenyl]acetamide |
| InChIKey | VGFDUXNDMUMYHD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)C2=CC(=C(C=C2)NC(=O)C)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)