CAS 869895-62-5 is the registry number for Dimethyl 1-[2-(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)ethyl]-1h-1,2,3-triazole-4,5-dicarboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Dimethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]triazole-4,5-dicarboxylate (CAS 869895-62-5) is a chemical compound with the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. IUPAC name: dimethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]triazole-4,5-dicarboxylate. InChIKey: JOBSOUOXPGIGBE-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O6 |
|---|---|
| Molecular weight | 358.31 g/mol |
| IUPAC name | dimethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]triazole-4,5-dicarboxylate |
| InChIKey | JOBSOUOXPGIGBE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=N1)CCN2C(=O)C3=CC=CC=C3C2=O)C(=O)OC |
Computed by PubChem (NCBI)