Products 63785-86-4

CAS 63785-86-4 is the registry number for 3-Bromopyridine n-oxide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-1-oxidopyridin-1-ium;hydrochloride (CAS 63785-86-4) is a chemical compound with the molecular formula C5H5BrClNO and a molecular weight of 210.45 g/mol. IUPAC name: 3-bromo-1-oxidopyridin-1-ium;hydrochloride. InChIKey: VJMWFTNOBOUFRF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5BrClNO
Molecular weight210.45 g/mol
IUPAC name3-bromo-1-oxidopyridin-1-ium;hydrochloride
InChIKeyVJMWFTNOBOUFRF-UHFFFAOYSA-N
SMILESC1=CC(=C[N+](=C1)[O-])Br.Cl

Computed by PubChem (NCBI)