CAS 63785-86-4 is the registry number for 3-Bromopyridine n-oxide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3-bromo-1-oxidopyridin-1-ium;hydrochloride (CAS 63785-86-4) is a chemical compound with the molecular formula C5H5BrClNO and a molecular weight of 210.45 g/mol. IUPAC name: 3-bromo-1-oxidopyridin-1-ium;hydrochloride. InChIKey: VJMWFTNOBOUFRF-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClNO |
|---|---|
| Molecular weight | 210.45 g/mol |
| IUPAC name | 3-bromo-1-oxidopyridin-1-ium;hydrochloride |
| InChIKey | VJMWFTNOBOUFRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])Br.Cl |
Computed by PubChem (NCBI)