CAS 80866-91-7 appears in our catalog under these names: 2-Bromopyridine n-oxide hydrochloride, 97%, 2-Bromopyridine N-Oxide Hydrochloride, 2-Bromopyridine 1-oxide hydrochloride, 97%, 2-Bromopyridine 1-oxide hydrochloride 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g, 100mg, 250mg, 500mg.
2-bromo-1-oxidopyridin-1-ium;hydrochloride (CAS 80866-91-7) is a chemical compound with the molecular formula C5H5BrClNO and a molecular weight of 210.45 g/mol. IUPAC name: 2-bromo-1-oxidopyridin-1-ium;hydrochloride. InChIKey: FRYPQGMFDZBQEW-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClNO |
|---|---|
| Molecular weight | 210.45 g/mol |
| IUPAC name | 2-bromo-1-oxidopyridin-1-ium;hydrochloride |
| InChIKey | FRYPQGMFDZBQEW-UHFFFAOYSA-N |
| SMILES | C1=CC=[N+](C(=C1)Br)[O-].Cl |
Computed by PubChem (NCBI)