Products 63820-72-4

CAS 63820-72-4 is the registry number for Methyl 2,5-dimethylnicotinate 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,5-dimethylpyridine-3-carboxylate (CAS 63820-72-4) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: methyl 2,5-dimethylpyridine-3-carboxylate. InChIKey: GUQFVDKBVSOKAE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2
Molecular weight165.19 g/mol
IUPAC namemethyl 2,5-dimethylpyridine-3-carboxylate
InChIKeyGUQFVDKBVSOKAE-UHFFFAOYSA-N
SMILESCC1=CC(=C(N=C1)C)C(=O)OC

Computed by PubChem (NCBI)