CAS 6386-58-9 appears in our catalog under these names: Warfarin Impurity 5, 4,4'-Disulfanediylbis(2,6-di-tert-butylphenol), 95%, Bis(3,5-di-tert-butylphen-4-ol) Disulfide, 4,4'-Dithio-bis(2,6-di-tert-butylphenol), Probucol dithiobisphenol. Offered by: Hubei YoungXin, Chemat Brand, TRC, Mikromol, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1g, Get quote.
2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)disulfanyl]phenol (CAS 6386-58-9) is a chemical compound with the molecular formula C28H42O2S2 and a molecular weight of 474.8 g/mol. IUPAC name: 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)disulfanyl]phenol. InChIKey: NEUPRVAMTYHIQV-UHFFFAOYSA-N.
| Molecular formula | C28H42O2S2 |
|---|---|
| Molecular weight | 474.8 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)disulfanyl]phenol |
| InChIKey | NEUPRVAMTYHIQV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)SSC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)