CAS 64953-47-5 is the registry number for 6,6'-Disulfanediylbis(2,4-di-tert-butylphenol), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)disulfanyl]phenol (CAS 64953-47-5) is a chemical compound with the molecular formula C28H42O2S2 and a molecular weight of 474.8 g/mol. IUPAC name: 2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)disulfanyl]phenol. InChIKey: OQNMSUCZVWYXHJ-UHFFFAOYSA-N.
| Molecular formula | C28H42O2S2 |
|---|---|
| Molecular weight | 474.8 g/mol |
| IUPAC name | 2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)disulfanyl]phenol |
| InChIKey | OQNMSUCZVWYXHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)SSC2=CC(=CC(=C2O)C(C)(C)C)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)