CAS 63895-01-2 is the registry number for N-Isopropyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine (CAS 63895-01-2) is a chemical compound with the molecular formula C11H15N3S and a molecular weight of 221.32 g/mol. IUPAC name: 5,6-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine. InChIKey: NFKJOBSMXAGHGG-UHFFFAOYSA-N.
| Molecular formula | C11H15N3S |
|---|---|
| Molecular weight | 221.32 g/mol |
| IUPAC name | 5,6-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine |
| InChIKey | NFKJOBSMXAGHGG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC=NC(=C12)NC(C)C)C |
Computed by PubChem (NCBI)