CAS 930447-23-7 is the registry number for N-Methyl-4-(1,2,5-trimethyl-1H-pyrrol-3-yl)thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-4-(1,2,5-trimethylpyrrol-3-yl)-1,3-thiazol-2-amine (CAS 930447-23-7) is a chemical compound with the molecular formula C11H15N3S and a molecular weight of 221.32 g/mol. IUPAC name: N-methyl-4-(1,2,5-trimethylpyrrol-3-yl)-1,3-thiazol-2-amine. InChIKey: JMCGWPFCJWLUEQ-UHFFFAOYSA-N.
| Molecular formula | C11H15N3S |
|---|---|
| Molecular weight | 221.32 g/mol |
| IUPAC name | N-methyl-4-(1,2,5-trimethylpyrrol-3-yl)-1,3-thiazol-2-amine |
| InChIKey | JMCGWPFCJWLUEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C)C)C2=CSC(=N2)NC |
Computed by PubChem (NCBI)