CAS 64057-67-6 appears in our catalog under these names: 1-(2-Bromophenyl)-2-methylpropan-2-amine hydrochloride, Benzeneethanamine, 2-bromo-α,α-dimethyl- hydrochloride, 98%, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
1-(2-bromophenyl)-2-methylpropan-2-amine;hydrochloride (CAS 64057-67-6) is a chemical compound with the molecular formula C10H15BrClN and a molecular weight of 264.59 g/mol. IUPAC name: 1-(2-bromophenyl)-2-methylpropan-2-amine;hydrochloride. InChIKey: FPZUHICPEXBVJW-UHFFFAOYSA-N.
| Molecular formula | C10H15BrClN |
|---|---|
| Molecular weight | 264.59 g/mol |
| IUPAC name | 1-(2-bromophenyl)-2-methylpropan-2-amine;hydrochloride |
| InChIKey | FPZUHICPEXBVJW-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=CC=C1Br)N.Cl |
Computed by PubChem (NCBI)