Products 640725-76-4
CAS 640725-76-4 appears in our catalog under these names: 2’-β-C-Ethynyladenosine, 2′-C-Ethynyladenosine. Offered by: MedChemExpress, Chemat. Available pack sizes: 25 mg, 100 mg, 5 mg, 50 mg, 10 mg, 1mg, 5mg.
(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol (CAS 640725-76-4) is a chemical compound with the molecular formula C12H13N5O4 and a molecular weight of 291.26 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: GLMZHZQENASCGE-YUTYNTIBSA-N.
| Molecular formula | C12H13N5O4 |
|---|---|
| Molecular weight | 291.26 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | GLMZHZQENASCGE-YUTYNTIBSA-N |
| SMILES | C#C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O)O |
Computed by PubChem (NCBI)