CAS 64090-98-8 appears in our catalog under these names: H-3-Pal-OH, 98%, 3-(3-Pyridyl)-L-alanine, 98% , H–Ala(3–pyridyl)–OH·HCl, (S)-2-Amino-3-(pyridin-3-yl)propanoic acid, 3-(3-Pyridyl)-L-alanine. Offered by: Chemat, Thermo Scientific (Alfa Aesar), GLPBio, TargetMol, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
(2S)-2-amino-3-pyridin-3-ylpropanoic acid (CAS 64090-98-8) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: (2S)-2-amino-3-pyridin-3-ylpropanoic acid. InChIKey: DFZVZEMNPGABKO-ZETCQYMHSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2S)-2-amino-3-pyridin-3-ylpropanoic acid |
| InChIKey | DFZVZEMNPGABKO-ZETCQYMHSA-N |
| SMILES | C1=CC(=CN=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)