Products 641-36-1
CAS 641-36-1 appears in our catalog under these names: Apocodeine, R-(-)-Apocodeine (1.0mg/ml in Acetonitrile), R-(-)-Apocodeine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10x1ml, 500mg, 50mg.
(6aR)-10-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol (CAS 641-36-1) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (6aR)-10-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol. InChIKey: DZUOQMBJJSBONO-CQSZACIVSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (6aR)-10-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol |
| InChIKey | DZUOQMBJJSBONO-CQSZACIVSA-N |
| SMILES | CN1CCC2=C3[C@H]1CC4=C(C3=CC=C2)C(=C(C=C4)OC)O |
Computed by PubChem (NCBI)