CAS 64165-36-2 is the registry number for Quinoline-6,8-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Quinoline-6,8-diol (CAS 64165-36-2) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: quinoline-6,8-diol. InChIKey: AMXUNCSKFJYPCR-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | quinoline-6,8-diol |
| InChIKey | AMXUNCSKFJYPCR-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)O)O |
Computed by PubChem (NCBI)