Products 64180-07-0

CAS 64180-07-0 is the registry number for 1-Methylindolin-5-amine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-methyl-2,3-dihydroindol-5-amine (CAS 64180-07-0) is a chemical compound with the molecular formula C9H12N2 and a molecular weight of 148.20 g/mol. IUPAC name: 1-methyl-2,3-dihydroindol-5-amine. InChIKey: JYSFDZGGGCGZGO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2
Molecular weight148.20 g/mol
IUPAC name1-methyl-2,3-dihydroindol-5-amine
InChIKeyJYSFDZGGGCGZGO-UHFFFAOYSA-N
SMILESCN1CCC2=C1C=CC(=C2)N

Computed by PubChem (NCBI)