CAS 64199-70-8 is the registry number for Isonopaline. Offered by: TRC. Available pack sizes: 100mg, 1g.
(2S)-2-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]pentanedioic acid (CAS 64199-70-8) is a chemical compound with the molecular formula C11H20N4O6 and a molecular weight of 304.30 g/mol. IUPAC name: (2S)-2-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]pentanedioic acid. InChIKey: LMKYZBGVKHTLTN-BQBZGAKWSA-N.
| Molecular formula | C11H20N4O6 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | (2S)-2-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]pentanedioic acid |
| InChIKey | LMKYZBGVKHTLTN-BQBZGAKWSA-N |
| SMILES | C(C[C@@H](C(=O)O)N[C@@H](CCC(=O)O)C(=O)O)CN=C(N)N |
Computed by PubChem (NCBI)