Products 75459-34-6
CAS 75459-34-6 appears in our catalog under these names: Dexrazoxane Impurity 3, ADR-925/ 98%, ADR-925, 98.00% ,, 98.00% ,, ADR-925. Offered by: Chemat Brand, TargetMol, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
2-[(2-amino-2-oxoethyl)-[2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]propyl]amino]acetic acid (CAS 75459-34-6) is a chemical compound with the molecular formula C11H20N4O6 and a molecular weight of 304.30 g/mol. IUPAC name: 2-[(2-amino-2-oxoethyl)-[2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]propyl]amino]acetic acid. InChIKey: YXWHFCSUHVBWFG-UHFFFAOYSA-N.
| Molecular formula | C11H20N4O6 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | 2-[(2-amino-2-oxoethyl)-[2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]propyl]amino]acetic acid |
| InChIKey | YXWHFCSUHVBWFG-UHFFFAOYSA-N |
| SMILES | CC(CN(CC(=O)N)CC(=O)O)N(CC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)