Products 64229-84-1

CAS 64229-84-1 is the registry number for Ethyl 2-methylcyclopent-1-ene-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-methylcyclopentene-1-carboxylate (CAS 64229-84-1) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. IUPAC name: ethyl 2-methylcyclopentene-1-carboxylate. InChIKey: OFSLDYNRTCQKFU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O2
Molecular weight154.21 g/mol
IUPAC nameethyl 2-methylcyclopentene-1-carboxylate
InChIKeyOFSLDYNRTCQKFU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(CCC1)C

Computed by PubChem (NCBI)