Products 64236-38-0
CAS 64236-38-0 appears in our catalog under these names: Petasol, 98.00%, Petasol. Offered by: Chemat, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg.
(3S,4aR,5R,6R)-6-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one (CAS 64236-38-0) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (3S,4aR,5R,6R)-6-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one. InChIKey: AJFPOVBARCSOLH-MUYACECFSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (3S,4aR,5R,6R)-6-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| InChIKey | AJFPOVBARCSOLH-MUYACECFSA-N |
| SMILES | C[C@H]1[C@@H](CCC2=CC(=O)[C@@H](C[C@]12C)C(=C)C)O |
Computed by PubChem (NCBI)