Products 64240-87-5

CAS 64240-87-5 is the registry number for Mesalazine Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 5-amino-2-hydroxybenzoate (CAS 64240-87-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: propan-2-yl 5-amino-2-hydroxybenzoate. InChIKey: QQSWKDRPBHPAAL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO3
Molecular weight195.21 g/mol
IUPAC namepropan-2-yl 5-amino-2-hydroxybenzoate
InChIKeyQQSWKDRPBHPAAL-UHFFFAOYSA-N
SMILESCC(C)OC(=O)C1=C(C=CC(=C1)N)O

Computed by PubChem (NCBI)