CAS 64240-87-5 is the registry number for Mesalazine Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 50mg.
Propan-2-yl 5-amino-2-hydroxybenzoate (CAS 64240-87-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: propan-2-yl 5-amino-2-hydroxybenzoate. InChIKey: QQSWKDRPBHPAAL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | propan-2-yl 5-amino-2-hydroxybenzoate |
| InChIKey | QQSWKDRPBHPAAL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=CC(=C1)N)O |
Computed by PubChem (NCBI)