CAS 6425-46-3 appears in our catalog under these names: 4-(4-Nitrobenzyl)morpholine, 98%, 4-(4-Nitrobenzyl)morpholine, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 10g.
4-[(4-nitrophenyl)methyl]morpholine (CAS 6425-46-3) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: 4-[(4-nitrophenyl)methyl]morpholine. InChIKey: KNTGXGBOYZAKTA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4-[(4-nitrophenyl)methyl]morpholine |
| InChIKey | KNTGXGBOYZAKTA-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)