CAS 64289-45-8 appears in our catalog under these names: 3-Amino-2,4-dimethylbenzoic acid, 95%, 3–Amino–2,4–dimethylbenzoic acid, 3-Amino-2,4-dimethylbenzoic acid, 95+%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-amino-2,4-dimethylbenzoic acid (CAS 64289-45-8) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 3-amino-2,4-dimethylbenzoic acid. InChIKey: OXASAUXTASIZPW-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 3-amino-2,4-dimethylbenzoic acid |
| InChIKey | OXASAUXTASIZPW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)O)C)N |
Computed by PubChem (NCBI)