CAS 6429-04-5 appears in our catalog under these names: Tetrahydropapaverine hydrochloride, rac-Nor Laudanosine Hydrochloride, >95% (HPLC), Tetrahydropapaverine HCl, Norlaudanosine Hydrochloride, >98.0%(HPLC)(N), Tetrahydropapaverine hydrochloride, 97%, 97%. Offered by: GLPBio, TRC, TCI, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1g, 250mg, 10mg, 50mg, 5g, 25g.
1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 6429-04-5) is a chemical compound with the molecular formula C20H26ClNO4 and a molecular weight of 379.9 g/mol. IUPAC name: 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: VMPLLPIDRGXFTQ-UHFFFAOYSA-N.
| Molecular formula | C20H26ClNO4 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | VMPLLPIDRGXFTQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC2C3=CC(=C(C=C3CCN2)OC)OC)OC.Cl |
Computed by PubChem (NCBI)