Products 64375-69-5
CAS 64375-69-5 is the registry number for 4-(4,8-Dichloro-2-methylquinolin-3-yl)butan-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(4,8-dichloro-2-methylquinolin-3-yl)butan-2-one (CAS 64375-69-5) is a chemical compound with the molecular formula C14H13Cl2NO and a molecular weight of 282.2 g/mol. IUPAC name: 4-(4,8-dichloro-2-methylquinolin-3-yl)butan-2-one. InChIKey: MOKWWJGOBBVWHO-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2NO |
|---|---|
| Molecular weight | 282.2 g/mol |
| IUPAC name | 4-(4,8-dichloro-2-methylquinolin-3-yl)butan-2-one |
| InChIKey | MOKWWJGOBBVWHO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C=CC=C(C2=N1)Cl)Cl)CCC(=O)C |
Computed by PubChem (NCBI)