CAS 878448-95-4 is the registry number for N-((5-(3,4-Dichlorophenyl)furan-2-yl)methyl)cyclopropanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]cyclopropanamine (CAS 878448-95-4) is a chemical compound with the molecular formula C14H13Cl2NO and a molecular weight of 282.2 g/mol. IUPAC name: N-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]cyclopropanamine. InChIKey: XNQBLHYSMWRECE-UHFFFAOYSA-N.
| Molecular formula | C14H13Cl2NO |
|---|---|
| Molecular weight | 282.2 g/mol |
| IUPAC name | N-[[5-(3,4-dichlorophenyl)furan-2-yl]methyl]cyclopropanamine |
| InChIKey | XNQBLHYSMWRECE-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=CC=C(O2)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)