Products 6456-78-6
CAS 6456-78-6 appears in our catalog under these names: 6-Chloro-8-quinolinecarboxylic Acid, 6-Chloroquinoline-8-carboxylic acid 98%, 6-Chloroquinoline-8-carboxylic acid, 98%, 6-Chloroquinoline-8-carboxylic acid, 98%, 98%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 1g, 5g, 10g, 25g.
6-chloroquinoline-8-carboxylic acid (CAS 6456-78-6) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 6-chloroquinoline-8-carboxylic acid. InChIKey: GGHKFVNCVUIGRP-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 6-chloroquinoline-8-carboxylic acid |
| InChIKey | GGHKFVNCVUIGRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)