CAS 64658-05-5 is the registry number for 2-Bromo-4-chloroquinoline, 98+%. Offered by: AmBeed. Available pack sizes: 5g.
2-bromo-4-chloroquinoline (CAS 64658-05-5) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 2-bromo-4-chloroquinoline. InChIKey: RCTLPGXYGNQCRD-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 2-bromo-4-chloroquinoline |
| InChIKey | RCTLPGXYGNQCRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)Br)Cl |
Computed by PubChem (NCBI)