CAS 647863-02-3 is the registry number for 2–(Trifluoromethyl)–5,6,7,8–tetrahydropyrido(3,4–d)pyrimidine. Offered by: GLPBio. Available pack sizes: 1g.
2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (CAS 647863-02-3) is a chemical compound with the molecular formula C8H8F3N3 and a molecular weight of 203.16 g/mol. IUPAC name: 2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine. InChIKey: OOHUOYPEBUGEJR-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N3 |
|---|---|
| Molecular weight | 203.16 g/mol |
| IUPAC name | 2-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| InChIKey | OOHUOYPEBUGEJR-UHFFFAOYSA-N |
| SMILES | C1CNCC2=NC(=NC=C21)C(F)(F)F |
Computed by PubChem (NCBI)