Products 64798-35-2
CAS 64798-35-2 appears in our catalog under these names: 2–(3–chlorophenyl)–2–methylpropanoic acid, 2-(3-Chlorophenyl)-2-methylpropanoic acid, 2-(3-Chlorophenyl)-2-methylpropanoic acid, 98%, 2-(3-Chlorophenyl)-2-methylpropanoic acid 98%, 2-(3-Chlorophenyl)-2-methylpropanoic acid, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 25g, 100mg.
2-(3-chlorophenyl)-2-methylpropanoic acid (CAS 64798-35-2) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-(3-chlorophenyl)-2-methylpropanoic acid. InChIKey: SFXNGYPSARMRKU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-2-methylpropanoic acid |
| InChIKey | SFXNGYPSARMRKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)