CAS 64820-57-1 is the registry number for 6-BROMO-2-CHLORO-4-PHENYLQUINAZOLINE, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.
6-bromo-2-chloro-4-phenylquinazoline (CAS 64820-57-1) is a chemical compound with the molecular formula C14H8BrClN2 and a molecular weight of 319.58 g/mol. IUPAC name: 6-bromo-2-chloro-4-phenylquinazoline. InChIKey: XHAZRLJQCFZAAJ-UHFFFAOYSA-N.
| Molecular formula | C14H8BrClN2 |
|---|---|
| Molecular weight | 319.58 g/mol |
| IUPAC name | 6-bromo-2-chloro-4-phenylquinazoline |
| InChIKey | XHAZRLJQCFZAAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC3=C2C=C(C=C3)Br)Cl |
Computed by PubChem (NCBI)