CAS 887592-38-3 is the registry number for 7-Bromo-4-chloro-2-phenylquinazoline, 97%. Offered by: AmBeed. Available pack sizes: 1g.
7-bromo-4-chloro-2-phenylquinazoline (CAS 887592-38-3) is a chemical compound with the molecular formula C14H8BrClN2 and a molecular weight of 319.58 g/mol. IUPAC name: 7-bromo-4-chloro-2-phenylquinazoline. InChIKey: CFJZNGSRNJLEKY-UHFFFAOYSA-N.
| Molecular formula | C14H8BrClN2 |
|---|---|
| Molecular weight | 319.58 g/mol |
| IUPAC name | 7-bromo-4-chloro-2-phenylquinazoline |
| InChIKey | CFJZNGSRNJLEKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC(=C3)Br)C(=N2)Cl |
Computed by PubChem (NCBI)