Products 65022-17-5
CAS 65022-17-5 is the registry number for H-Ala-Pro-pNA*HCl. Offered by: Iris Biotech. Available pack sizes: 250mg, 500mg, 1g, 5g.
(2S)-1-[(2S)-2-aminopropanoyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride (CAS 65022-17-5) is a chemical compound with the molecular formula C14H19ClN4O4 and a molecular weight of 342.78 g/mol. IUPAC name: (2S)-1-[(2S)-2-aminopropanoyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride. InChIKey: MYWOEAKMMDWWIZ-CSDGMEMJSA-N.
| Molecular formula | C14H19ClN4O4 |
|---|---|
| Molecular weight | 342.78 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-aminopropanoyl]-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride |
| InChIKey | MYWOEAKMMDWWIZ-CSDGMEMJSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)