CAS 755039-53-3 is the registry number for (R)-Methyl 2-((2-chloro-5-nitropyrimidin-4-yl)(cyclopentyl)amino)butanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (2R)-2-[(2-chloro-5-nitropyrimidin-4-yl)-cyclopentylamino]butanoate (CAS 755039-53-3) is a chemical compound with the molecular formula C14H19ClN4O4 and a molecular weight of 342.78 g/mol. IUPAC name: methyl (2R)-2-[(2-chloro-5-nitropyrimidin-4-yl)-cyclopentylamino]butanoate. InChIKey: GXVLUDDQFWMGHW-SNVBAGLBSA-N.
| Molecular formula | C14H19ClN4O4 |
|---|---|
| Molecular weight | 342.78 g/mol |
| IUPAC name | methyl (2R)-2-[(2-chloro-5-nitropyrimidin-4-yl)-cyclopentylamino]butanoate |
| InChIKey | GXVLUDDQFWMGHW-SNVBAGLBSA-N |
| SMILES | CC[C@H](C(=O)OC)N(C1CCCC1)C2=NC(=NC=C2[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)