CAS 650635-67-9 is the registry number for 2,5-Dimethylbenzo[d]thiazol-4-amine 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,5-dimethyl-1,3-benzothiazol-4-amine (CAS 650635-67-9) is a chemical compound with the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. IUPAC name: 2,5-dimethyl-1,3-benzothiazol-4-amine. InChIKey: HMYFXZPQFWZJIY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S |
|---|---|
| Molecular weight | 178.26 g/mol |
| IUPAC name | 2,5-dimethyl-1,3-benzothiazol-4-amine |
| InChIKey | HMYFXZPQFWZJIY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)SC(=N2)C)N |
Computed by PubChem (NCBI)