CAS 65100-49-4 appears in our catalog under these names: Desipramine-d3, >95% (HPLC), Desipramine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine (CAS 65100-49-4) is a chemical compound with the molecular formula C18H22N2 and a molecular weight of 269.4 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine. InChIKey: HCYAFALTSJYZDH-FIBGUPNXSA-N.
| Molecular formula | C18H22N2 |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine |
| InChIKey | HCYAFALTSJYZDH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCCCN1C2=CC=CC=C2CCC3=CC=CC=C31 |
Computed by PubChem (NCBI)