Products 651056-77-8
CAS 651056-77-8 is the registry number for 4-Methyl-1-(methylsulfonyl)piperidin-4-amine hydrochloride, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
4-methyl-1-methylsulfonylpiperidin-4-amine;hydrochloride (CAS 651056-77-8) is a chemical compound with the molecular formula C7H17ClN2O2S and a molecular weight of 228.74 g/mol. IUPAC name: 4-methyl-1-methylsulfonylpiperidin-4-amine;hydrochloride. InChIKey: DVZGNAPXNSYMIT-UHFFFAOYSA-N.
| Molecular formula | C7H17ClN2O2S |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 4-methyl-1-methylsulfonylpiperidin-4-amine;hydrochloride |
| InChIKey | DVZGNAPXNSYMIT-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)