CAS 1062059-60-2 appears in our catalog under these names: 1-(Propane-2-sulfonyl)piperazine hydrochloride, 1-(Isopropylsulfonyl)piperazine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.
1-propan-2-ylsulfonylpiperazine;hydrochloride (CAS 1062059-60-2) is a chemical compound with the molecular formula C7H17ClN2O2S and a molecular weight of 228.74 g/mol. IUPAC name: 1-propan-2-ylsulfonylpiperazine;hydrochloride. InChIKey: GHDZKBUEDABELG-UHFFFAOYSA-N.
| Molecular formula | C7H17ClN2O2S |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 1-propan-2-ylsulfonylpiperazine;hydrochloride |
| InChIKey | GHDZKBUEDABELG-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)N1CCNCC1.Cl |
Computed by PubChem (NCBI)