CAS 956034-29-0 is the registry number for N,N-Dimethylpiperidine-4-sulfonamide Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
N,N-dimethylpiperidine-4-sulfonamide;hydrochloride (CAS 956034-29-0) is a chemical compound with the molecular formula C7H17ClN2O2S and a molecular weight of 228.74 g/mol. IUPAC name: N,N-dimethylpiperidine-4-sulfonamide;hydrochloride. InChIKey: ISCJPEJPLAOFAD-UHFFFAOYSA-N.
| Molecular formula | C7H17ClN2O2S |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | N,N-dimethylpiperidine-4-sulfonamide;hydrochloride |
| InChIKey | ISCJPEJPLAOFAD-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1CCNCC1.Cl |
Computed by PubChem (NCBI)